C16H27N3O3 — CID 72846213
[2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]methanone (PubChem CID 72846213) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]methanone.
| Compound Name | [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 72846213 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | [2-(2-ethoxyethyl)-5-methylpyrazol-3-yl]-[(3R)-3-hydroxy-3,4,4-trimethylpyrrolidin-1-yl]methanone |
| SMILES | CCOCCn1nc(C)cc1C(=O)N1CC(C)(C)[C@@](C)(O)C1 |
| InChI | InChI=1S/C16H27N3O3/c1-6-22-8-7-19-13(9-12(2)17-19)14(20)18-10-15(3,4)16(5,21)11-18/h9,21H,6-8,10-11H2,1-5H3/t16-/m0/s1 |
| InChIKey | LOZYIFCCDOLKME-INIZCTEOSA-N |
| XLogP | 1.46 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|