C19H27N5O2 — CID 72846922
(3aR,6aR)-5-(6-piperidin-1-ylpyrimidin-4-yl)-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72846922) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is (3aR,6aR)-5-(6-piperidin-1-ylpyrimidin-4-yl)-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-(6-piperidin-1-ylpyrimidin-4-yl)-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72846922 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | (3aR,6aR)-5-(6-piperidin-1-ylpyrimidin-4-yl)-2-prop-2-enyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | C=CCN1C[C@@H]2CN(c3cc(N4CCCCC4)ncn3)C[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H27N5O2/c1-2-6-22-10-15-11-24(13-19(15,12-22)18(25)26)17-9-16(20-14-21-17)23-7-4-3-5-8-23/h2,9,14-15H,1,3-8,10-13H2,(H,25,26)/t15-,19-/m1/s1 |
| InChIKey | VWJRCFFUOGIQRS-DNVCBOLYSA-N |
| XLogP | 1.48 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|