About 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid
1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 72847481) has the molecular formula C17H27N3O4
and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| PubChem CID | 72847481 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | COCCC1(C(=O)O)CCCN(C(=O)CCc2c(C)n[nH]c2C)C1 |
| InChI | InChI=1S/C17H27N3O4/c1-12-14(13(2)19-18-12)5-6-15(21)20-9-4-7-17(11-20,16(22)23)8-10-24-3/h4-11H2,1-3H3,(H,18,19)(H,22,23) |
| InChIKey | UIDVJRCHJUPGAA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid (CID 72847481) is 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid is COCCC1(C(=O)O)CCCN(C(=O)CCc2c(C)n[nH]c2C)C1.
What is the InChIKey of 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid?
The InChIKey is UIDVJRCHJUPGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O4/c1-12-14(13(2)19-18-12)5-6-15(21)20-9-4-7-17(11-20,16(22)23)8-10-24-3/h4-11H2,1-3H3,(H,18,19)(H,22,23).
What are the key properties of 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid?
1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid has a molecular weight of 337.42 g/mol, XLogP of 1.69, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoyl]-3-(2-methoxyethyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 72847481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).