C17H19N5O2S — CID 72847648
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide (PubChem CID 72847648) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
|---|---|
| PubChem CID | 72847648 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
| SMILES | Nc1nc(CCCNC(=O)CCc2nc3ccccc3[nH]c2=O)cs1 |
| InChI | InChI=1S/C17H19N5O2S/c18-17-20-11(10-25-17)4-3-9-19-15(23)8-7-14-16(24)22-13-6-2-1-5-12(13)21-14/h1-2,5-6,10H,3-4,7-9H2,(H2,18,20)(H,19,23)(H,22,24) |
| InChIKey | YYHVKSCTHYJFSI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|