C16H20N2O4 — CID 72847861
1-N'-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 72847861) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-N'-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 72847861 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-N'-[(8-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cccc2c1OCC(CNC(=O)C1(C(N)=O)CC1)C2 |
| InChI | InChI=1S/C16H20N2O4/c1-21-12-4-2-3-11-7-10(9-22-13(11)12)8-18-15(20)16(5-6-16)14(17)19/h2-4,10H,5-9H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | PRIAQDIOOMAOAP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|