C23H30N6 — CID 72848013
1-(2-methyl-6-propylpyrimidin-4-yl)-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-amine (PubChem CID 72848013) has the molecular formula C23H30N6 and a molecular weight of 390.54 g/mol. Its IUPAC name is 1-(2-methyl-6-propylpyrimidin-4-yl)-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-amine.
| Compound Name | 1-(2-methyl-6-propylpyrimidin-4-yl)-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 72848013 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-(2-methyl-6-propylpyrimidin-4-yl)-N-[(1-phenylpyrazol-4-yl)methyl]piperidin-4-amine |
| SMILES | CCCc1cc(N2CCC(NCc3cnn(-c4ccccc4)c3)CC2)nc(C)n1 |
| InChI | InChI=1S/C23H30N6/c1-3-7-21-14-23(27-18(2)26-21)28-12-10-20(11-13-28)24-15-19-16-25-29(17-19)22-8-5-4-6-9-22/h4-6,8-9,14,16-17,20,24H,3,7,10-13,15H2,1-2H3 |
| InChIKey | FZZBVVFBUYCJIV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |