About N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine
N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine (PubChem CID 72848464) has the molecular formula C14H13N5O
and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine |
| PubChem CID | 72848464 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine |
| SMILES | c1ccc(Cc2nc(CNc3ncccn3)no2)cc1 |
| InChI | InChI=1S/C14H13N5O/c1-2-5-11(6-3-1)9-13-18-12(19-20-13)10-17-14-15-7-4-8-16-14/h1-8H,9-10H2,(H,15,16,17) |
| InChIKey | OASZNLAGYWGOHW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine?
The IUPAC name of N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine (CID 72848464) is N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine.
What is the SMILES notation for N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine?
The canonical SMILES for N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine is c1ccc(Cc2nc(CNc3ncccn3)no2)cc1.
What is the InChIKey of N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine?
The InChIKey is OASZNLAGYWGOHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5O/c1-2-5-11(6-3-1)9-13-18-12(19-20-13)10-17-14-15-7-4-8-16-14/h1-8H,9-10H2,(H,15,16,17).
What are the key properties of N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine?
N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine has a molecular weight of 267.29 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-benzyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidin-2-amine is sourced from PubChem (CID 72848464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).