About 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea
1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea (PubChem CID 72848515) has the molecular formula C9H13F3N4OS
and a molecular weight of 282.29 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea |
| PubChem CID | 72848515 |
| Molecular Formula | C9H13F3N4OS |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea |
| SMILES | Cc1nn(C)cc1NC(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C9H13F3N4OS/c1-6-7(5-16(2)15-6)14-8(17)13-3-4-18-9(10,11)12/h5H,3-4H2,1-2H3,(H2,13,14,17) |
| InChIKey | UJVVIMRUDXUYJX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea?
The IUPAC name of 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea (CID 72848515) is 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea.
What is the SMILES notation for 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea?
The canonical SMILES for 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea is Cc1nn(C)cc1NC(=O)NCCSC(F)(F)F.
What is the InChIKey of 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea?
The InChIKey is UJVVIMRUDXUYJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N4OS/c1-6-7(5-16(2)15-6)14-8(17)13-3-4-18-9(10,11)12/h5H,3-4H2,1-2H3,(H2,13,14,17).
What are the key properties of 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea?
1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea has a molecular weight of 282.29 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dimethylpyrazol-4-yl)-3-[2-(trifluoromethylsulfanyl)ethyl]urea is sourced from PubChem (CID 72848515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).