C21H23ClFN3O2 — CID 72848529
3-(3-chloro-1,2-oxazol-5-yl)-1-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]propan-1-one (PubChem CID 72848529) has the molecular formula C21H23ClFN3O2 and a molecular weight of 403.89 g/mol. Its IUPAC name is 3-(3-chloro-1,2-oxazol-5-yl)-1-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]propan-1-one.
| Compound Name | 3-(3-chloro-1,2-oxazol-5-yl)-1-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]propan-1-one |
|---|---|
| PubChem CID | 72848529 |
| Molecular Formula | C21H23ClFN3O2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-(3-chloro-1,2-oxazol-5-yl)-1-[(2R,3R,6R)-3-(4-fluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]propan-1-one |
| SMILES | O=C(CCc1cc(Cl)no1)N1C[C@@H](c2ccc(F)cc2)[C@@H]2[C@H]1C1CCN2CC1 |
| InChI | InChI=1S/C21H23ClFN3O2/c22-18-11-16(28-24-18)5-6-19(27)26-12-17(13-1-3-15(23)4-2-13)21-20(26)14-7-9-25(21)10-8-14/h1-4,11,14,17,20-21H,5-10,12H2/t17-,20+,21+/m0/s1 |
| InChIKey | YDJXBHRGLHYSON-IOMROCGXSA-N |
| XLogP | 3.49 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |