C18H33N3O4 — CID 72849133
3-(3-methoxypropyl)-1-[2-(4-methyl-1,4-diazepan-1-yl)acetyl]piperidine-3-carboxylic acid (PubChem CID 72849133) has the molecular formula C18H33N3O4 and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1-[2-(4-methyl-1,4-diazepan-1-yl)acetyl]piperidine-3-carboxylic acid.
| Compound Name | 3-(3-methoxypropyl)-1-[2-(4-methyl-1,4-diazepan-1-yl)acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 72849133 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 3-(3-methoxypropyl)-1-[2-(4-methyl-1,4-diazepan-1-yl)acetyl]piperidine-3-carboxylic acid |
| SMILES | COCCCC1(C(=O)O)CCCN(C(=O)CN2CCCN(C)CC2)C1 |
| InChI | InChI=1S/C18H33N3O4/c1-19-8-5-9-20(12-11-19)14-16(22)21-10-3-6-18(15-21,17(23)24)7-4-13-25-2/h3-15H2,1-2H3,(H,23,24) |
| InChIKey | AMFBVNAXEOKHPV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|