About N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide
N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 72849662) has the molecular formula C10H21N3O3S
and a molecular weight of 263.36 g/mol. Its IUPAC name is N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide |
| PubChem CID | 72849662 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | CCC[C@H]1CN(C(=O)CNS(C)(=O)=O)C[C@@H]1N |
| InChI | InChI=1S/C10H21N3O3S/c1-3-4-8-6-13(7-9(8)11)10(14)5-12-17(2,15)16/h8-9,12H,3-7,11H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | KLWQDPPLMLTIAE-IUCAKERBSA-N |
| XLogP | -0.88 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide?
The IUPAC name of N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide (CID 72849662) is N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide.
What is the SMILES notation for N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide?
The canonical SMILES for N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide is CCC[C@H]1CN(C(=O)CNS(C)(=O)=O)C[C@@H]1N.
What is the InChIKey of N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide?
The InChIKey is KLWQDPPLMLTIAE-IUCAKERBSA-N. The full InChI is InChI=1S/C10H21N3O3S/c1-3-4-8-6-13(7-9(8)11)10(14)5-12-17(2,15)16/h8-9,12H,3-7,11H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide?
N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide has a molecular weight of 263.36 g/mol, XLogP of -0.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3R,4S)-3-amino-4-propylpyrrolidin-1-yl]-2-oxoethyl]methanesulfonamide is sourced from PubChem (CID 72849662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).