C20H23NO3S — CID 72849704
1-[(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 72849704) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 72849704 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[(3aS,9bS)-3a-(hydroxymethyl)-1,3,4,9b-tetrahydrochromeno[3,4-c]pyrrol-2-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)N1C[C@@H]2c3ccccc3OC[C@]2(CO)C1 |
| InChI | InChI=1S/C20H23NO3S/c22-13-20-12-21(19(23)9-3-5-15-6-4-10-25-15)11-17(20)16-7-1-2-8-18(16)24-14-20/h1-2,4,6-8,10,17,22H,3,5,9,11-14H2/t17-,20-/m1/s1 |
| InChIKey | HYAOHUXKPACEPB-YLJYHZDGSA-N |
| XLogP | 3.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |