C18H26N4O3S — CID 72850002
(3aR,6aR)-5-acetyl-2-[(2-butylsulfanylpyrimidin-5-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72850002) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is (3aR,6aR)-5-acetyl-2-[(2-butylsulfanylpyrimidin-5-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-acetyl-2-[(2-butylsulfanylpyrimidin-5-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72850002 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (3aR,6aR)-5-acetyl-2-[(2-butylsulfanylpyrimidin-5-yl)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCCCSc1ncc(CN2C[C@@H]3CN(C(C)=O)C[C@]3(C(=O)O)C2)cn1 |
| InChI | InChI=1S/C18H26N4O3S/c1-3-4-5-26-17-19-6-14(7-20-17)8-21-9-15-10-22(13(2)23)12-18(15,11-21)16(24)25/h6-7,15H,3-5,8-12H2,1-2H3,(H,24,25)/t15-,18-/m1/s1 |
| InChIKey | JNJJWCCXOCUIIY-CRAIPNDOSA-N |
| XLogP | 1.73 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|