C16H27N4O3+ — CID 7285010
cyclohexyl-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propyl]azanium (PubChem CID 7285010) has the molecular formula C16H27N4O3+ and a molecular weight of 323.42 g/mol. Its IUPAC name is cyclohexyl-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propyl]azanium.
| Compound Name | cyclohexyl-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propyl]azanium |
|---|---|
| PubChem CID | 7285010 |
| Molecular Formula | C16H27N4O3+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | cyclohexyl-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]propyl]azanium |
| SMILES | CN1C(=O)C(/C=N/CCC[NH2+]C2CCCCC2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C16H26N4O3/c1-19-14(21)13(15(22)20(2)16(19)23)11-17-9-6-10-18-12-7-4-3-5-8-12/h11-13,18H,3-10H2,1-2H3/p+1/b17-11+ |
| InChIKey | ZWWBXCPYVCMUHL-GZTJUZNOSA-O |
| XLogP | 0.01 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|