C20H21N5O3 — CID 72850721
4-(1,3-benzodioxol-5-ylmethyl)-N-(1H-indazol-6-yl)piperazine-1-carboxamide (PubChem CID 72850721) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-(1H-indazol-6-yl)piperazine-1-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-(1H-indazol-6-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 72850721 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-(1H-indazol-6-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H21N5O3/c26-20(22-16-3-2-15-11-21-23-17(15)10-16)25-7-5-24(6-8-25)12-14-1-4-18-19(9-14)28-13-27-18/h1-4,9-11H,5-8,12-13H2,(H,21,23)(H,22,26) |
| InChIKey | AGGQRAXLJNPPRU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |