C16H18FN3O — CID 72851395
4-(4-Fluorophenyl)-1-(4-methylpyrimidin-2-YL)piperidin-4-OL (PubChem CID 72851395) has the molecular formula C16H18FN3O and a molecular weight of 287.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-(4-methylpyrimidin-2-yl)piperidin-4-ol.
| Compound Name | 4-(4-Fluorophenyl)-1-(4-methylpyrimidin-2-YL)piperidin-4-OL |
|---|---|
| PubChem CID | 72851395 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-(4-fluorophenyl)-1-(4-methylpyrimidin-2-yl)piperidin-4-ol |
| SMILES | CC1=NC(=NC=C1)N2CCC(CC2)(C3=CC=C(C=C3)F)O |
| InChI | InChI=1S/C16H18FN3O/c1-12-6-9-18-15(19-12)20-10-7-16(21,8-11-20)13-2-4-14(17)5-3-13/h2-6,9,21H,7-8,10-11H2,1H3 |
| InChIKey | YZDLPLDXVOUWBZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 338 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |