About 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one
6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one (PubChem CID 72851821) has the molecular formula C14H15N3O2S
and a molecular weight of 289.36 g/mol. Its IUPAC name is 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one |
| PubChem CID | 72851821 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one |
| SMILES | O=C(Cn1ccc2ncccc2c1=O)N1CCSCC1 |
| InChI | InChI=1S/C14H15N3O2S/c18-13(16-6-8-20-9-7-16)10-17-5-3-12-11(14(17)19)2-1-4-15-12/h1-5H,6-10H2 |
| InChIKey | GTZQERRBPULHGB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one?
The IUPAC name of 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one (CID 72851821) is 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one.
What is the SMILES notation for 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one?
The canonical SMILES for 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one is O=C(Cn1ccc2ncccc2c1=O)N1CCSCC1.
What is the InChIKey of 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one?
The InChIKey is GTZQERRBPULHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2S/c18-13(16-6-8-20-9-7-16)10-17-5-3-12-11(14(17)19)2-1-4-15-12/h1-5H,6-10H2.
What are the key properties of 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one?
6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one has a molecular weight of 289.36 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-oxo-2-thiomorpholin-4-ylethyl)-1,6-naphthyridin-5-one is sourced from PubChem (CID 72851821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).