C13H18N4O3S — CID 72851970
(3aS,6aS)-5-acetyl-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72851970) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is (3aS,6aS)-5-acetyl-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-5-acetyl-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72851970 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (3aS,6aS)-5-acetyl-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCc1nnc(N2C[C@@H]3CN(C(C)=O)C[C@]3(C(=O)O)C2)s1 |
| InChI | InChI=1S/C13H18N4O3S/c1-3-10-14-15-12(21-10)17-5-9-4-16(8(2)18)6-13(9,7-17)11(19)20/h9H,3-7H2,1-2H3,(H,19,20)/t9-,13-/m0/s1 |
| InChIKey | JZUMOYDDRFKQTE-ZANVPECISA-N |
| XLogP | 0.47 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |