C15H22FN5O3 — CID 72852007
(3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72852007) has the molecular formula C15H22FN5O3 and a molecular weight of 339.37 g/mol. Its IUPAC name is (3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72852007 |
| Molecular Formula | C15H22FN5O3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3aR,6aR)-5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-2-(2-methoxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CNc1nc(N2C[C@H]3CN(CCOC)C[C@@]3(C(=O)O)C2)ncc1F |
| InChI | InChI=1S/C15H22FN5O3/c1-17-12-11(16)5-18-14(19-12)21-7-10-6-20(3-4-24-2)8-15(10,9-21)13(22)23/h5,10H,3-4,6-9H2,1-2H3,(H,22,23)(H,17,18,19)/t10-,15-/m1/s1 |
| InChIKey | WXXHZIFOEHYTTD-MEBBXXQBSA-N |
| XLogP | 0.13 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |