C19H20N2O4 — CID 72852455
4-[1-[2-(2-oxo-1-pyridinyl)acetyl]piperidin-3-yl]benzoic acid (PubChem CID 72852455) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[1-[2-(2-oxo-1-pyridinyl)acetyl]piperidin-3-yl]benzoic acid.
| Compound Name | 4-[1-[2-(2-oxo-1-pyridinyl)acetyl]piperidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 72852455 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-[1-[2-(2-oxo-1-pyridinyl)acetyl]piperidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2CCCN(C(=O)Cn3ccccc3=O)C2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c22-17-5-1-2-10-21(17)13-18(23)20-11-3-4-16(12-20)14-6-8-15(9-7-14)19(24)25/h1-2,5-10,16H,3-4,11-13H2,(H,24,25) |
| InChIKey | BJBRTVPABHHNFD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |