C16H19NO5 — CID 7285344
(4R)-5,5,6,6-tetramethoxy-4-phenyl-4H-pyran-3-carbonitrile (PubChem CID 7285344) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (4R)-5,5,6,6-tetramethoxy-4-phenyl-4H-pyran-3-carbonitrile.
| Compound Name | (4R)-5,5,6,6-tetramethoxy-4-phenyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 7285344 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (4R)-5,5,6,6-tetramethoxy-4-phenyl-4H-pyran-3-carbonitrile |
| SMILES | COC1(OC)OC=C(C#N)[C@@H](c2ccccc2)C1(OC)OC |
| InChI | InChI=1S/C16H19NO5/c1-18-15(19-2)14(12-8-6-5-7-9-12)13(10-17)11-22-16(15,20-3)21-4/h5-9,11,14H,1-4H3/t14-/m1/s1 |
| InChIKey | HULCTWQDMZDEJS-CQSZACIVSA-N |
| XLogP | 2.14 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|