C21H27N7O — CID 72853686
N-methyl-3-[1-(7H-purin-6-yl)piperidin-3-yl]-N-(2-pyridin-2-ylethyl)propanamide (PubChem CID 72853686) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is N-methyl-3-[1-(7H-purin-6-yl)piperidin-3-yl]-N-(2-pyridin-2-ylethyl)propanamide.
| Compound Name | N-methyl-3-[1-(7H-purin-6-yl)piperidin-3-yl]-N-(2-pyridin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 72853686 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-methyl-3-[1-(7H-purin-6-yl)piperidin-3-yl]-N-(2-pyridin-2-ylethyl)propanamide |
| SMILES | CN(CCc1ccccn1)C(=O)CCC1CCCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C21H27N7O/c1-27(12-9-17-6-2-3-10-22-17)18(29)8-7-16-5-4-11-28(13-16)21-19-20(24-14-23-19)25-15-26-21/h2-3,6,10,14-16H,4-5,7-9,11-13H2,1H3,(H,23,24,25,26) |
| InChIKey | FKGQMZGJDUYXED-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |