C14H22N4O3S — CID 72854015
[(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-(3-methyl-1-propylpyrazol-4-yl)methanone (PubChem CID 72854015) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is [(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-(3-methyl-1-propylpyrazol-4-yl)methanone.
| Compound Name | [(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-(3-methyl-1-propylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 72854015 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(4aS,7aR)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-(3-methyl-1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1cc(C(=O)N2CCN[C@H]3CS(=O)(=O)C[C@H]32)c(C)n1 |
| InChI | InChI=1S/C14H22N4O3S/c1-3-5-17-7-11(10(2)16-17)14(19)18-6-4-15-12-8-22(20,21)9-13(12)18/h7,12-13,15H,3-6,8-9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | XJEFDPXTVDOZRJ-QWHCGFSZSA-N |
| XLogP | -0.19 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |