About 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one
4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one (PubChem CID 72854217) has the molecular formula C17H26N4O2
and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one |
| PubChem CID | 72854217 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one |
| SMILES | CN(CC1CC(=O)N(C2CCCC2)C1)c1nnc(C2CCC2)o1 |
| InChI | InChI=1S/C17H26N4O2/c1-20(17-19-18-16(23-17)13-5-4-6-13)10-12-9-15(22)21(11-12)14-7-2-3-8-14/h12-14H,2-11H2,1H3 |
| InChIKey | AMKSMWGWWUEDQN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one?
The IUPAC name of 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one (CID 72854217) is 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one.
What is the SMILES notation for 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one?
The canonical SMILES for 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one is CN(CC1CC(=O)N(C2CCCC2)C1)c1nnc(C2CCC2)o1.
What is the InChIKey of 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one?
The InChIKey is AMKSMWGWWUEDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O2/c1-20(17-19-18-16(23-17)13-5-4-6-13)10-12-9-15(22)21(11-12)14-7-2-3-8-14/h12-14H,2-11H2,1H3.
What are the key properties of 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one?
4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one has a molecular weight of 318.42 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-methylamino]methyl]-1-cyclopentylpyrrolidin-2-one is sourced from PubChem (CID 72854217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).