C23H26N4O — CID 72854237
1-(3,3-diphenylpiperidin-1-yl)-4-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 72854237) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-(3,3-diphenylpiperidin-1-yl)-4-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-(3,3-diphenylpiperidin-1-yl)-4-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 72854237 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 1-(3,3-diphenylpiperidin-1-yl)-4-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | O=C(CCCn1cncn1)N1CCCC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H26N4O/c28-22(13-7-16-27-19-24-18-25-27)26-15-8-14-23(17-26,20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-6,9-12,18-19H,7-8,13-17H2 |
| InChIKey | OFVCUEFXQGYWPG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |