C15H23N7O — CID 72854321
4-N-[[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methyl]-4-N-methyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine (PubChem CID 72854321) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is 4-N-[[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methyl]-4-N-methyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine.
| Compound Name | 4-N-[[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methyl]-4-N-methyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 72854321 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 4-N-[[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]methyl]-4-N-methyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
| SMILES | COCCn1cnnc1CN(C)c1nc(N)nc2c1CCCC2 |
| InChI | InChI=1S/C15H23N7O/c1-21(9-13-20-17-10-22(13)7-8-23-2)14-11-5-3-4-6-12(11)18-15(16)19-14/h10H,3-9H2,1-2H3,(H2,16,18,19) |
| InChIKey | ZUBWGQBFIXXSAA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |