C13H13F3N4O2S2 — CID 72854341
3-[[5-(2-methyl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 72854341) has the molecular formula C13H13F3N4O2S2 and a molecular weight of 378.40 g/mol. Its IUPAC name is 3-[[5-(2-methyl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 3-[[5-(2-methyl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 72854341 |
| Molecular Formula | C13H13F3N4O2S2 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 3-[[5-(2-methyl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | Cc1nc(-c2nc(CC3C=CS(=O)(=O)C3)n(CC(F)(F)F)n2)cs1 |
| InChI | InChI=1S/C13H13F3N4O2S2/c1-8-17-10(5-23-8)12-18-11(20(19-12)7-13(14,15)16)4-9-2-3-24(21,22)6-9/h2-3,5,9H,4,6-7H2,1H3 |
| InChIKey | SBGXKWXBUODSGV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |