C19H26N6O — CID 72854864
1-[4-[4-cyclopropyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one (PubChem CID 72854864) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-[4-[4-cyclopropyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one.
| Compound Name | 1-[4-[4-cyclopropyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 72854864 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-[4-[4-cyclopropyl-5-(pyrazol-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC(c2nnc(Cn3cccn3)n2C2CC2)CC1 |
| InChI | InChI=1S/C19H26N6O/c1-2-3-5-18(26)23-12-8-15(9-13-23)19-22-21-17(25(19)16-6-7-16)14-24-11-4-10-20-24/h2,4,10-11,15-16H,1,3,5-9,12-14H2 |
| InChIKey | FSOSWXLTRUQCFA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|