About N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide
N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide (PubChem CID 7285508) has the molecular formula C18H17Cl2N5O
and a molecular weight of 390.27 g/mol. Its IUPAC name is N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide.
Molecular Properties
| Compound Name | N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide |
| PubChem CID | 7285508 |
| Molecular Formula | C18H17Cl2N5O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide |
| SMILES | Cc1cccc(C)c1-n1nnnc1[C@@H](c1ccc(Cl)cc1Cl)N(C)C=O |
| InChI | InChI=1S/C18H17Cl2N5O/c1-11-5-4-6-12(2)16(11)25-18(21-22-23-25)17(24(3)10-26)14-8-7-13(19)9-15(14)20/h4-10,17H,1-3H3/t17-/m1/s1 |
| InChIKey | KMLOOJGRIQUYDE-QGZVFWFLSA-N |
| XLogP | 3.76 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide?
The IUPAC name of N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide (CID 7285508) is N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide.
What is the SMILES notation for N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide?
The canonical SMILES for N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide is Cc1cccc(C)c1-n1nnnc1[C@@H](c1ccc(Cl)cc1Cl)N(C)C=O.
What is the InChIKey of N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide?
The InChIKey is KMLOOJGRIQUYDE-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H17Cl2N5O/c1-11-5-4-6-12(2)16(11)25-18(21-22-23-25)17(24(3)10-26)14-8-7-13(19)9-15(14)20/h4-10,17H,1-3H3/t17-/m1/s1.
What are the key properties of N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide?
N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide has a molecular weight of 390.27 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(R)-(2,4-dichlorophenyl)-[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl]-N-methylformamide is sourced from PubChem (CID 7285508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).