About (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol
(3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol (PubChem CID 72855191) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol.
Molecular Properties
| Compound Name | (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol |
| PubChem CID | 72855191 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol |
| SMILES | C[C@@]1(O)CCN(Cc2cncn2C2CCCC2)C[C@@H]1O |
| InChI | InChI=1S/C15H25N3O2/c1-15(20)6-7-17(10-14(15)19)9-13-8-16-11-18(13)12-4-2-3-5-12/h8,11-12,14,19-20H,2-7,9-10H2,1H3/t14-,15+/m0/s1 |
| InChIKey | PJBLINDHXDILEX-LSDHHAIUSA-N |
| XLogP | 1.32 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol?
The IUPAC name of (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol (CID 72855191) is (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol.
What is the SMILES notation for (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol?
The canonical SMILES for (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol is C[C@@]1(O)CCN(Cc2cncn2C2CCCC2)C[C@@H]1O.
What is the InChIKey of (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol?
The InChIKey is PJBLINDHXDILEX-LSDHHAIUSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-15(20)6-7-17(10-14(15)19)9-13-8-16-11-18(13)12-4-2-3-5-12/h8,11-12,14,19-20H,2-7,9-10H2,1H3/t14-,15+/m0/s1.
What are the key properties of (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol?
(3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol has a molecular weight of 279.38 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-[(3-cyclopentylimidazol-4-yl)methyl]-4-methylpiperidine-3,4-diol is sourced from PubChem (CID 72855191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).