C18H21FN2O — CID 72855355
1-[1-(3-fluoro-4-pyridinyl)piperidin-4-yl]-2-phenylethanol (PubChem CID 72855355) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-pyridinyl)piperidin-4-yl]-2-phenylethanol.
| Compound Name | 1-[1-(3-fluoro-4-pyridinyl)piperidin-4-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 72855355 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[1-(3-fluoro-4-pyridinyl)piperidin-4-yl]-2-phenylethanol |
| SMILES | OC(Cc1ccccc1)C1CCN(c2ccncc2F)CC1 |
| InChI | InChI=1S/C18H21FN2O/c19-16-13-20-9-6-17(16)21-10-7-15(8-11-21)18(22)12-14-4-2-1-3-5-14/h1-6,9,13,15,18,22H,7-8,10-12H2 |
| InChIKey | NYWBLFJYAGSXTO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |