C17H26N6 — CID 72855544
4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1-[(E)-2-methylbut-2-enyl]piperidine (PubChem CID 72855544) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1-[(E)-2-methylbut-2-enyl]piperidine.
| Compound Name | 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1-[(E)-2-methylbut-2-enyl]piperidine |
|---|---|
| PubChem CID | 72855544 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]-1-[(E)-2-methylbut-2-enyl]piperidine |
| SMILES | C/C=C(\C)CN1CCC(c2nnc(Cn3ccnc3)n2C)CC1 |
| InChI | InChI=1S/C17H26N6/c1-4-14(2)11-22-8-5-15(6-9-22)17-20-19-16(21(17)3)12-23-10-7-18-13-23/h4,7,10,13,15H,5-6,8-9,11-12H2,1-3H3/b14-4+ |
| InChIKey | SQNSTYZLCILHJH-LNKIKWGQSA-N |
| XLogP | 2.21 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|