About N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide
N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide (PubChem CID 72855560) has the molecular formula C18H18N4O3
and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide |
| PubChem CID | 72855560 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide |
| SMILES | COc1ccc2c(c1)OCC(CNC(=O)c1ccc3n[nH]nc3c1)C2 |
| InChI | InChI=1S/C18H18N4O3/c1-24-14-4-2-12-6-11(10-25-17(12)8-14)9-19-18(23)13-3-5-15-16(7-13)21-22-20-15/h2-5,7-8,11H,6,9-10H2,1H3,(H,19,23)(H,20,21,22) |
| InChIKey | SGUDTTODUQRHHM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide?
The IUPAC name of N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide (CID 72855560) is N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide.
What is the SMILES notation for N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide?
The canonical SMILES for N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide is COc1ccc2c(c1)OCC(CNC(=O)c1ccc3n[nH]nc3c1)C2.
What is the InChIKey of N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide?
The InChIKey is SGUDTTODUQRHHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3/c1-24-14-4-2-12-6-11(10-25-17(12)8-14)9-19-18(23)13-3-5-15-16(7-13)21-22-20-15/h2-5,7-8,11H,6,9-10H2,1H3,(H,19,23)(H,20,21,22).
What are the key properties of N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide?
N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide has a molecular weight of 338.37 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7-methoxy-3,4-dihydro-2H-chromen-3-yl)methyl]-2H-benzotriazole-5-carboxamide is sourced from PubChem (CID 72855560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).