C20H33N5 — CID 72855572
4-[4-cyclopropyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)piperidine (PubChem CID 72855572) has the molecular formula C20H33N5 and a molecular weight of 343.52 g/mol. Its IUPAC name is 4-[4-cyclopropyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)piperidine.
| Compound Name | 4-[4-cyclopropyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)piperidine |
|---|---|
| PubChem CID | 72855572 |
| Molecular Formula | C20H33N5 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 4-[4-cyclopropyl-5-(pyrrolidin-1-ylmethyl)-1,2,4-triazol-3-yl]-1-(3-methylbut-2-enyl)piperidine |
| SMILES | CC(C)=CCN1CCC(c2nnc(CN3CCCC3)n2C2CC2)CC1 |
| InChI | InChI=1S/C20H33N5/c1-16(2)7-12-23-13-8-17(9-14-23)20-22-21-19(25(20)18-5-6-18)15-24-10-3-4-11-24/h7,17-18H,3-6,8-15H2,1-2H3 |
| InChIKey | ALMCHFZKPYLLPN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|