C18H24N4O4 — CID 72855625
6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decane-8-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 72855625) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decane-8-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decane-8-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72855625 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decane-8-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)=CCN1CC2(CCN(C(=O)c3cc(=O)[nH]c(=O)[nH]3)CC2)CC1=O |
| InChI | InChI=1S/C18H24N4O4/c1-12(2)3-6-22-11-18(10-15(22)24)4-7-21(8-5-18)16(25)13-9-14(23)20-17(26)19-13/h3,9H,4-8,10-11H2,1-2H3,(H2,19,20,23,26) |
| InChIKey | WWVAPPUQDWFOLU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|