About 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid
3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid (PubChem CID 72855723) has the molecular formula C21H29N3O2
and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid |
| PubChem CID | 72855723 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid |
| SMILES | Cc1ccc2ncccc2c1CN1CC[C@H](N(C)C)[C@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C21H29N3O2/c1-15-6-8-19-17(5-4-11-22-19)18(15)14-24-12-10-20(23(2)3)16(13-24)7-9-21(25)26/h4-6,8,11,16,20H,7,9-10,12-14H2,1-3H3,(H,25,26)/t16-,20+/m1/s1 |
| InChIKey | BNGUPRLZFRDWBJ-UZLBHIALSA-N |
| XLogP | 3.16 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid?
The IUPAC name of 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid (CID 72855723) is 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid.
What is the SMILES notation for 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid?
The canonical SMILES for 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid is Cc1ccc2ncccc2c1CN1CC[C@H](N(C)C)[C@H](CCC(=O)O)C1.
What is the InChIKey of 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid?
The InChIKey is BNGUPRLZFRDWBJ-UZLBHIALSA-N. The full InChI is InChI=1S/C21H29N3O2/c1-15-6-8-19-17(5-4-11-22-19)18(15)14-24-12-10-20(23(2)3)16(13-24)7-9-21(25)26/h4-6,8,11,16,20H,7,9-10,12-14H2,1-3H3,(H,25,26)/t16-,20+/m1/s1.
What are the key properties of 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid?
3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid has a molecular weight of 355.48 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4S)-4-(dimethylamino)-1-[(6-methylquinolin-5-yl)methyl]piperidin-3-yl]propanoic acid is sourced from PubChem (CID 72855723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).