C15H16F3N3O4 — CID 7285638
2-[(5R)-3-ethyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide (PubChem CID 7285638) has the molecular formula C15H16F3N3O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-[(5R)-3-ethyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-[(5R)-3-ethyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 7285638 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-[(5R)-3-ethyl-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-N-(4-methoxyphenyl)-2-oxoacetamide |
| SMILES | CCC1=NN(C(=O)C(=O)Nc2ccc(OC)cc2)[C@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H16F3N3O4/c1-3-9-8-14(24,15(16,17)18)21(20-9)13(23)12(22)19-10-4-6-11(25-2)7-5-10/h4-7,24H,3,8H2,1-2H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | WPNBEFVLUHAOOQ-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|