C13H20N4O2 — CID 72856574
(3aR,5R,6S,7aS)-2-(6-amino-2-methylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol (PubChem CID 72856574) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is (3aR,5R,6S,7aS)-2-(6-amino-2-methylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol.
| Compound Name | (3aR,5R,6S,7aS)-2-(6-amino-2-methylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
|---|---|
| PubChem CID | 72856574 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (3aR,5R,6S,7aS)-2-(6-amino-2-methylpyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
| SMILES | Cc1nc(N)cc(N2C[C@H]3C[C@H](O)[C@H](O)C[C@H]3C2)n1 |
| InChI | InChI=1S/C13H20N4O2/c1-7-15-12(14)4-13(16-7)17-5-8-2-10(18)11(19)3-9(8)6-17/h4,8-11,18-19H,2-3,5-6H2,1H3,(H2,14,15,16)/t8-,9+,10+,11- |
| InChIKey | SMHPDFPOPRVMTQ-CKIJPRSSSA-N |
| XLogP | -0.06 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |