C17H21ClN4O3 — CID 72856586
5-chloro-3-[4-[1-(2-methoxyethyl)imidazol-2-yl]piperidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 72856586) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 5-chloro-3-[4-[1-(2-methoxyethyl)imidazol-2-yl]piperidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 5-chloro-3-[4-[1-(2-methoxyethyl)imidazol-2-yl]piperidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 72856586 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 5-chloro-3-[4-[1-(2-methoxyethyl)imidazol-2-yl]piperidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | COCCn1ccnc1C1CCN(C(=O)c2cc(Cl)c[nH]c2=O)CC1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-25-9-8-21-7-4-19-15(21)12-2-5-22(6-3-12)17(24)14-10-13(18)11-20-16(14)23/h4,7,10-12H,2-3,5-6,8-9H2,1H3,(H,20,23) |
| InChIKey | QMWYMHHNRYATCB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |