C17H23N5 — CID 72856835
5-ethyl-4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-2-amine (PubChem CID 72856835) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 5-ethyl-4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-2-amine.
| Compound Name | 5-ethyl-4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 72856835 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 5-ethyl-4-[4-(4-methylphenyl)piperazin-1-yl]pyrimidin-2-amine |
| SMILES | CCc1cnc(N)nc1N1CCN(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H23N5/c1-3-14-12-19-17(18)20-16(14)22-10-8-21(9-11-22)15-6-4-13(2)5-7-15/h4-7,12H,3,8-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | SHTOMZHBTGKIQR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|