About N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide
N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide (PubChem CID 72856858) has the molecular formula C17H29N3O2
and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide |
| PubChem CID | 72856858 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide |
| SMILES | Cc1noc(C)c1CCCNC(=O)C1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C17H29N3O2/c1-12(2)20-10-7-15(8-11-20)17(21)18-9-5-6-16-13(3)19-22-14(16)4/h12,15H,5-11H2,1-4H3,(H,18,21) |
| InChIKey | ZCOHRWABYLEOMK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide?
The IUPAC name of N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide (CID 72856858) is N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide.
What is the SMILES notation for N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide?
The canonical SMILES for N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide is Cc1noc(C)c1CCCNC(=O)C1CCN(C(C)C)CC1.
What is the InChIKey of N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide?
The InChIKey is ZCOHRWABYLEOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O2/c1-12(2)20-10-7-15(8-11-20)17(21)18-9-5-6-16-13(3)19-22-14(16)4/h12,15H,5-11H2,1-4H3,(H,18,21).
What are the key properties of N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide?
N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide has a molecular weight of 307.44 g/mol, XLogP of 2.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-1-propan-2-ylpiperidine-4-carboxamide is sourced from PubChem (CID 72856858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).