About 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane
9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane (PubChem CID 72857697) has the molecular formula C17H22N4O
and a molecular weight of 298.39 g/mol. Its IUPAC name is 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane |
| PubChem CID | 72857697 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane |
| SMILES | Cc1cc(C)c2c(N3CCOC4(CCCC4)C3)ncnc2n1 |
| InChI | InChI=1S/C17H22N4O/c1-12-9-13(2)20-15-14(12)16(19-11-18-15)21-7-8-22-17(10-21)5-3-4-6-17/h9,11H,3-8,10H2,1-2H3 |
| InChIKey | AOPACGYHKGKQRO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane?
The IUPAC name of 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane (CID 72857697) is 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane.
What is the SMILES notation for 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane?
The canonical SMILES for 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane is Cc1cc(C)c2c(N3CCOC4(CCCC4)C3)ncnc2n1.
What is the InChIKey of 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane?
The InChIKey is AOPACGYHKGKQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O/c1-12-9-13(2)20-15-14(12)16(19-11-18-15)21-7-8-22-17(10-21)5-3-4-6-17/h9,11H,3-8,10H2,1-2H3.
What are the key properties of 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane?
9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane has a molecular weight of 298.39 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(5,7-dimethylpyrido[2,3-d]pyrimidin-4-yl)-6-oxa-9-azaspiro[4.5]decane is sourced from PubChem (CID 72857697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).