About [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone
[(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone (PubChem CID 72857919) has the molecular formula C15H22N4O
and a molecular weight of 274.37 g/mol. Its IUPAC name is [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone.
Molecular Properties
| Compound Name | [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone |
| PubChem CID | 72857919 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone |
| SMILES | CC(C)c1nccc(C(=O)N2C[C@H](C3CC3)[C@@H](N)C2)n1 |
| InChI | InChI=1S/C15H22N4O/c1-9(2)14-17-6-5-13(18-14)15(20)19-7-11(10-3-4-10)12(16)8-19/h5-6,9-12H,3-4,7-8,16H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | XHTYCEAONPFIPR-NEPJUHHUSA-N |
| XLogP | 1.41 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone?
The IUPAC name of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone (CID 72857919) is [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone.
What is the SMILES notation for [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone?
The canonical SMILES for [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone is CC(C)c1nccc(C(=O)N2C[C@H](C3CC3)[C@@H](N)C2)n1.
What is the InChIKey of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone?
The InChIKey is XHTYCEAONPFIPR-NEPJUHHUSA-N. The full InChI is InChI=1S/C15H22N4O/c1-9(2)14-17-6-5-13(18-14)15(20)19-7-11(10-3-4-10)12(16)8-19/h5-6,9-12H,3-4,7-8,16H2,1-2H3/t11-,12+/m1/s1.
What are the key properties of [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone?
[(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone has a molecular weight of 274.37 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-amino-4-cyclopropylpyrrolidin-1-yl]-(2-propan-2-ylpyrimidin-4-yl)methanone is sourced from PubChem (CID 72857919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).