About 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione
6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 72858085) has the molecular formula C14H19N3O4
and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 72858085 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | C=CCC1(CO)CCCN(C(=O)c2cc(=O)[nH]c(=O)[nH]2)C1 |
| InChI | InChI=1S/C14H19N3O4/c1-2-4-14(9-18)5-3-6-17(8-14)12(20)10-7-11(19)16-13(21)15-10/h2,7,18H,1,3-6,8-9H2,(H2,15,16,19,21) |
| InChIKey | ZKDXHJIQQJQAJI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione (CID 72858085) is 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione is C=CCC1(CO)CCCN(C(=O)c2cc(=O)[nH]c(=O)[nH]2)C1.
What is the InChIKey of 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione?
The InChIKey is ZKDXHJIQQJQAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O4/c1-2-4-14(9-18)5-3-6-17(8-14)12(20)10-7-11(19)16-13(21)15-10/h2,7,18H,1,3-6,8-9H2,(H2,15,16,19,21).
What are the key properties of 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione?
6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione has a molecular weight of 293.32 g/mol, XLogP of -0.15, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 72858085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).