C14H19N3O4 — CID 72858085
6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 72858085) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72858085 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 6-[3-(hydroxymethyl)-3-prop-2-enylpiperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | C=CCC1(CO)CCCN(C(=O)c2cc(=O)[nH]c(=O)[nH]2)C1 |
| InChI | InChI=1S/C14H19N3O4/c1-2-4-14(9-18)5-3-6-17(8-14)12(20)10-7-11(19)16-13(21)15-10/h2,7,18H,1,3-6,8-9H2,(H2,15,16,19,21) |
| InChIKey | ZKDXHJIQQJQAJI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|