About 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one
1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one (PubChem CID 72858226) has the molecular formula C12H15N5OS
and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one |
| PubChem CID | 72858226 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one |
| SMILES | Cc1nc(NCCN2CCNC2=O)c2ccsc2n1 |
| InChI | InChI=1S/C12H15N5OS/c1-8-15-10(9-2-7-19-11(9)16-8)13-3-5-17-6-4-14-12(17)18/h2,7H,3-6H2,1H3,(H,14,18)(H,13,15,16) |
| InChIKey | JXTSKZFCFCLBLD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one?
The IUPAC name of 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one (CID 72858226) is 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one is Cc1nc(NCCN2CCNC2=O)c2ccsc2n1.
What is the InChIKey of 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one?
The InChIKey is JXTSKZFCFCLBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5OS/c1-8-15-10(9-2-7-19-11(9)16-8)13-3-5-17-6-4-14-12(17)18/h2,7H,3-6H2,1H3,(H,14,18)(H,13,15,16).
What are the key properties of 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one?
1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one has a molecular weight of 277.35 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]imidazolidin-2-one is sourced from PubChem (CID 72858226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).