C18H28N2O3 — CID 72858248
3-methoxy-N-[(3R,4S)-1-[(E)-2-methylbut-2-enyl]-4-(5-methylfuran-2-yl)pyrrolidin-3-yl]propanamide (PubChem CID 72858248) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-methoxy-N-[(3R,4S)-1-[(E)-2-methylbut-2-enyl]-4-(5-methylfuran-2-yl)pyrrolidin-3-yl]propanamide.
| Compound Name | 3-methoxy-N-[(3R,4S)-1-[(E)-2-methylbut-2-enyl]-4-(5-methylfuran-2-yl)pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 72858248 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 3-methoxy-N-[(3R,4S)-1-[(E)-2-methylbut-2-enyl]-4-(5-methylfuran-2-yl)pyrrolidin-3-yl]propanamide |
| SMILES | C/C=C(\C)CN1C[C@H](NC(=O)CCOC)[C@@H](c2ccc(C)o2)C1 |
| InChI | InChI=1S/C18H28N2O3/c1-5-13(2)10-20-11-15(17-7-6-14(3)23-17)16(12-20)19-18(21)8-9-22-4/h5-7,15-16H,8-12H2,1-4H3,(H,19,21)/b13-5+/t15-,16-/m0/s1 |
| InChIKey | SJBLFOAPSXMDEN-RIKNHUIHSA-N |
| XLogP | 2.47 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|