About 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol
9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol (PubChem CID 72859712) has the molecular formula C13H20N2O3S
and a molecular weight of 284.38 g/mol. Its IUPAC name is 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol.
Molecular Properties
| Compound Name | 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol |
| PubChem CID | 72859712 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol |
| SMILES | OCc1csc(N2CCC3(CC2)OCCCC3O)n1 |
| InChI | InChI=1S/C13H20N2O3S/c16-8-10-9-19-12(14-10)15-5-3-13(4-6-15)11(17)2-1-7-18-13/h9,11,16-17H,1-8H2 |
| InChIKey | AOGNVMITJQUBKK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol?
The IUPAC name of 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol (CID 72859712) is 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol.
What is the SMILES notation for 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol?
The canonical SMILES for 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol is OCc1csc(N2CCC3(CC2)OCCCC3O)n1.
What is the InChIKey of 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol?
The InChIKey is AOGNVMITJQUBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3S/c16-8-10-9-19-12(14-10)15-5-3-13(4-6-15)11(17)2-1-7-18-13/h9,11,16-17H,1-8H2.
What are the key properties of 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol?
9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol has a molecular weight of 284.38 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(hydroxymethyl)-1,3-thiazol-2-yl]-1-oxa-9-azaspiro[5.5]undecan-5-ol is sourced from PubChem (CID 72859712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).