C16H20F3N3O — CID 72861534
2-methyl-N-(2,4,5-trifluorophenyl)-2,7-diazaspiro[4.5]decane-7-carboxamide (PubChem CID 72861534) has the molecular formula C16H20F3N3O and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-methyl-N-(2,4,5-trifluorophenyl)-2,7-diazaspiro[4.5]decane-7-carboxamide.
| Compound Name | 2-methyl-N-(2,4,5-trifluorophenyl)-2,7-diazaspiro[4.5]decane-7-carboxamide |
|---|---|
| PubChem CID | 72861534 |
| Molecular Formula | C16H20F3N3O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-methyl-N-(2,4,5-trifluorophenyl)-2,7-diazaspiro[4.5]decane-7-carboxamide |
| SMILES | CN1CCC2(CCCN(C(=O)Nc3cc(F)c(F)cc3F)C2)C1 |
| InChI | InChI=1S/C16H20F3N3O/c1-21-6-4-16(9-21)3-2-5-22(10-16)15(23)20-14-8-12(18)11(17)7-13(14)19/h7-8H,2-6,9-10H2,1H3,(H,20,23) |
| InChIKey | ROMQBOFTVXFIIU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|