C12H19N7S — CID 72861624
4-N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 72861624) has the molecular formula C12H19N7S and a molecular weight of 293.40 g/mol. Its IUPAC name is 4-N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 72861624 |
| Molecular Formula | C12H19N7S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-N-[2-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | CCn1c(C)nnc1SCCNc1cc(C)nc(N)n1 |
| InChI | InChI=1S/C12H19N7S/c1-4-19-9(3)17-18-12(19)20-6-5-14-10-7-8(2)15-11(13)16-10/h7H,4-6H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | WPLJVRPIZFXDSQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|