About (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol
(4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol (PubChem CID 72861737) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol |
| PubChem CID | 72861737 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol |
| SMILES | COC[C@]1(O)CCN(c2cnc(C)c(C)n2)CC1(C)C |
| InChI | InChI=1S/C15H25N3O2/c1-11-12(2)17-13(8-16-11)18-7-6-15(19,10-20-5)14(3,4)9-18/h8,19H,6-7,9-10H2,1-5H3/t15-/m1/s1 |
| InChIKey | CAYAYVLPGLFUIY-OAHLLOKOSA-N |
| XLogP | 1.71 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
The IUPAC name of (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol (CID 72861737) is (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol.
What is the SMILES notation for (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
The canonical SMILES for (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol is COC[C@]1(O)CCN(c2cnc(C)c(C)n2)CC1(C)C.
What is the InChIKey of (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
The InChIKey is CAYAYVLPGLFUIY-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-11-12(2)17-13(8-16-11)18-7-6-15(19,10-20-5)14(3,4)9-18/h8,19H,6-7,9-10H2,1-5H3/t15-/m1/s1.
What are the key properties of (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol?
(4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol has a molecular weight of 279.38 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-(5,6-dimethylpyrazin-2-yl)-4-(methoxymethyl)-3,3-dimethylpiperidin-4-ol is sourced from PubChem (CID 72861737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).